Products 73667-71-7
CAS 73667-71-7 appears in our catalog under these names: 1,2’-O-Dimethylguanosine, >95% (HPLC), 1,2'-O-Dimethylguanosine, N1,2’-O-dimethylguanosine. Offered by: TRC, Biosynth, Chemat, MedChemExpress. Available pack sizes: 10mg, 2,5mg, 25mg, 50mg, 1mg, 5mg, 25 mg, 10 mg.
2-amino-9-[(2R,3R,4R,5R)-4-hydroxy-5-(hydroxymethyl)-3-methoxyoxolan-2-yl]-1-methylpurin-6-one (CAS 73667-71-7) is a chemical compound with the molecular formula C12H17N5O5 and a molecular weight of 311.29 g/mol. IUPAC name: 2-amino-9-[(2R,3R,4R,5R)-4-hydroxy-5-(hydroxymethyl)-3-methoxyoxolan-2-yl]-1-methylpurin-6-one. InChIKey: JLYURAYAEKVGQJ-IOSLPCCCSA-N.
| Molecular formula | C12H17N5O5 |
|---|---|
| Molecular weight | 311.29 g/mol |
| IUPAC name | 2-amino-9-[(2R,3R,4R,5R)-4-hydroxy-5-(hydroxymethyl)-3-methoxyoxolan-2-yl]-1-methylpurin-6-one |
| InChIKey | JLYURAYAEKVGQJ-IOSLPCCCSA-N |
| SMILES | CN1C(=O)C2=C(N=C1N)N(C=N2)[C@H]3[C@@H]([C@@H]([C@H](O3)CO)O)OC |
Computed by PubChem (NCBI)