CAS 2306782-64-7 appears in our catalog under these names: 2′–O–Methyl–8–methyl guanosine, 8-methyl-2'-O-methylguanosine, 98.61%, 98.61%, 2′-O-Methyl-8-methyl guanosine, 98.04%. Offered by: GLPBio, Chemat, MedChemExpress. Available pack sizes: 10mg, 25mg, 5mg, 10mM (in 1ml dmso), 1mg, 5 mg, 10mM/1mL, 100 mg.
2-amino-9-[(2R,3R,4R,5R)-4-hydroxy-5-(hydroxymethyl)-3-methoxyoxolan-2-yl]-8-methyl-1H-purin-6-one (CAS 2306782-64-7) is a chemical compound with the molecular formula C12H17N5O5 and a molecular weight of 311.29 g/mol. IUPAC name: 2-amino-9-[(2R,3R,4R,5R)-4-hydroxy-5-(hydroxymethyl)-3-methoxyoxolan-2-yl]-8-methyl-1H-purin-6-one. InChIKey: VKBDRYNPOJCCAX-IOSLPCCCSA-N.
| Molecular formula | C12H17N5O5 |
|---|---|
| Molecular weight | 311.29 g/mol |
| IUPAC name | 2-amino-9-[(2R,3R,4R,5R)-4-hydroxy-5-(hydroxymethyl)-3-methoxyoxolan-2-yl]-8-methyl-1H-purin-6-one |
| InChIKey | VKBDRYNPOJCCAX-IOSLPCCCSA-N |
| SMILES | CC1=NC2=C(N1[C@H]3[C@@H]([C@@H]([C@H](O3)CO)O)OC)N=C(NC2=O)N |
Computed by PubChem (NCBI)