Products 1942858-50-5
CAS 1942858-50-5 appears in our catalog under these names: Benzyl 2-methyl-2-(methylsulfonyl)pent-4-enoate, 95%, Benzyl 2–methyl–2–(methylsulfonyl)pent–4–enoate. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
Benzyl 2-methyl-2-methylsulfonylpent-4-enoate (CAS 1942858-50-5) is a chemical compound with the molecular formula C14H18O4S and a molecular weight of 282.36 g/mol. IUPAC name: benzyl 2-methyl-2-methylsulfonylpent-4-enoate. InChIKey: IWUXUMPMYUOEIY-UHFFFAOYSA-N.
| Molecular formula | C14H18O4S |
|---|---|
| Molecular weight | 282.36 g/mol |
| IUPAC name | benzyl 2-methyl-2-methylsulfonylpent-4-enoate |
| InChIKey | IWUXUMPMYUOEIY-UHFFFAOYSA-N |
| SMILES | CC(CC=C)(C(=O)OCC1=CC=CC=C1)S(=O)(=O)C |
Computed by PubChem (NCBI)