CAS 923221-20-9 appears in our catalog under these names: 1-[(2,5-Dimethylphenyl)sulfonyl]cyclopentanecarboxylic acid, 95%, 1-(2,5-Dimethylbenzenesulfonyl)cyclopentane-1-carboxylic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
1-(2,5-dimethylphenyl)sulfonylcyclopentane-1-carboxylic acid (CAS 923221-20-9) is a chemical compound with the molecular formula C14H18O4S and a molecular weight of 282.36 g/mol. IUPAC name: 1-(2,5-dimethylphenyl)sulfonylcyclopentane-1-carboxylic acid. InChIKey: ZQMMAZSLYLQABQ-UHFFFAOYSA-N.
| Molecular formula | C14H18O4S |
|---|---|
| Molecular weight | 282.36 g/mol |
| IUPAC name | 1-(2,5-dimethylphenyl)sulfonylcyclopentane-1-carboxylic acid |
| InChIKey | ZQMMAZSLYLQABQ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C)S(=O)(=O)C2(CCCC2)C(=O)O |
Computed by PubChem (NCBI)