CAS 505071-94-3 appears in our catalog under these names: 1-((3,4-Dimethylphenyl)sulfonyl)cyclopentanecarboxylic acid, 95+%, 1-(3,4-Dimethyl-benzenesulfonyl)-cyclopentane-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.
1-(3,4-dimethylphenyl)sulfonylcyclopentane-1-carboxylic acid (CAS 505071-94-3) is a chemical compound with the molecular formula C14H18O4S and a molecular weight of 282.36 g/mol. IUPAC name: 1-(3,4-dimethylphenyl)sulfonylcyclopentane-1-carboxylic acid. InChIKey: OLJLBERQLGMFSY-UHFFFAOYSA-N.
| Molecular formula | C14H18O4S |
|---|---|
| Molecular weight | 282.36 g/mol |
| IUPAC name | 1-(3,4-dimethylphenyl)sulfonylcyclopentane-1-carboxylic acid |
| InChIKey | OLJLBERQLGMFSY-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)S(=O)(=O)C2(CCCC2)C(=O)O)C |
Computed by PubChem (NCBI)