Products 2955561-33-6
CAS 2955561-33-6 is the registry number for 3-oxabicyclo[3.1.1]heptan-1-ylmethyl 4-methylbenzenesulfonate, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
3-oxabicyclo[3.1.1]heptan-1-ylmethyl 4-methylbenzenesulfonate (CAS 2955561-33-6) is a chemical compound with the molecular formula C14H18O4S and a molecular weight of 282.36 g/mol. IUPAC name: 3-oxabicyclo[3.1.1]heptan-1-ylmethyl 4-methylbenzenesulfonate. InChIKey: HJIGKXQASZEQST-UHFFFAOYSA-N.
| Molecular formula | C14H18O4S |
|---|---|
| Molecular weight | 282.36 g/mol |
| IUPAC name | 3-oxabicyclo[3.1.1]heptan-1-ylmethyl 4-methylbenzenesulfonate |
| InChIKey | HJIGKXQASZEQST-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCC23CC(C2)COC3 |
Computed by PubChem (NCBI)