CAS 19430-31-0 is the registry number for 2-Chloro-5-(4-chlorophenyl)-1,3,4-thiadiazole. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-chloro-5-(4-chlorophenyl)-1,3,4-thiadiazole (CAS 19430-31-0) is a chemical compound with the molecular formula C8H4Cl2N2S and a molecular weight of 231.10 g/mol. IUPAC name: 2-chloro-5-(4-chlorophenyl)-1,3,4-thiadiazole. InChIKey: UVTBFAQZJPMCIT-UHFFFAOYSA-N.
| Molecular formula | C8H4Cl2N2S |
|---|---|
| Molecular weight | 231.10 g/mol |
| IUPAC name | 2-chloro-5-(4-chlorophenyl)-1,3,4-thiadiazole |
| InChIKey | UVTBFAQZJPMCIT-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NN=C(S2)Cl)Cl |
Computed by PubChem (NCBI)