CAS 63558-75-8 is the registry number for 2,4–Dichloro–5–(3–thienyl)pyrimidine. Offered by: GLPBio. Available pack sizes: 1g, 250mg.
2,4-dichloro-5-thiophen-3-ylpyrimidine (CAS 63558-75-8) is a chemical compound with the molecular formula C8H4Cl2N2S and a molecular weight of 231.10 g/mol. IUPAC name: 2,4-dichloro-5-thiophen-3-ylpyrimidine. InChIKey: BJBFJJVZAWOKCI-UHFFFAOYSA-N.
| Molecular formula | C8H4Cl2N2S |
|---|---|
| Molecular weight | 231.10 g/mol |
| IUPAC name | 2,4-dichloro-5-thiophen-3-ylpyrimidine |
| InChIKey | BJBFJJVZAWOKCI-UHFFFAOYSA-N |
| SMILES | C1=CSC=C1C2=CN=C(N=C2Cl)Cl |
Computed by PubChem (NCBI)