CAS 36894-93-6 appears in our catalog under these names: 2-Chloro-5-(2-chlorophenyl)-1,3,4-thiadiazole, 2-Chloro-5-(2-chlorophenyl)-1,3,4-thiadiazole, 95%, 95%, 2-Chloro-5-(2-chlorophenyl)-1,3,4-thiadiazole, 95%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 0,5g, 50mg, 100mg, 250mg, 1g.
2-chloro-5-(2-chlorophenyl)-1,3,4-thiadiazole (CAS 36894-93-6) is a chemical compound with the molecular formula C8H4Cl2N2S and a molecular weight of 231.10 g/mol. IUPAC name: 2-chloro-5-(2-chlorophenyl)-1,3,4-thiadiazole. InChIKey: FMAFUQQVKRNJGP-UHFFFAOYSA-N.
| Molecular formula | C8H4Cl2N2S |
|---|---|
| Molecular weight | 231.10 g/mol |
| IUPAC name | 2-chloro-5-(2-chlorophenyl)-1,3,4-thiadiazole |
| InChIKey | FMAFUQQVKRNJGP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=NN=C(S2)Cl)Cl |
Computed by PubChem (NCBI)