Products 1945942-35-7
CAS 1945942-35-7 is the registry number for (Z)-2-[5-Methoxy-2-methyl-1-(3,4,5-trimethoxybenzylidene)-3-indenyl]acetic Acid, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g.
2-[(3Z)-6-methoxy-2-methyl-3-[(3,4,5-trimethoxyphenyl)methylidene]inden-1-yl]acetic acid (CAS 1945942-35-7) is a chemical compound with the molecular formula C23H24O6 and a molecular weight of 396.4 g/mol. IUPAC name: 2-[(3Z)-6-methoxy-2-methyl-3-[(3,4,5-trimethoxyphenyl)methylidene]inden-1-yl]acetic acid. InChIKey: JJVPDXNWNNEKAR-IUXPMGMMSA-N.
| Molecular formula | C23H24O6 |
|---|---|
| Molecular weight | 396.4 g/mol |
| IUPAC name | 2-[(3Z)-6-methoxy-2-methyl-3-[(3,4,5-trimethoxyphenyl)methylidene]inden-1-yl]acetic acid |
| InChIKey | JJVPDXNWNNEKAR-IUXPMGMMSA-N |
| SMILES | CC\1=C(C2=C(/C1=C\C3=CC(=C(C(=C3)OC)OC)OC)C=CC(=C2)OC)CC(=O)O |
Computed by PubChem (NCBI)