Products 1949-51-5
CAS 1949-51-5 appears in our catalog under these names: Ethyl 3,5-diaminobenzoate, 95%, Ethyl 3,5-diaminobenzoate, Ethyl 3,5-diaminobenzoate 95%, Ethyl 3,5-diaminobenzoate, 95%, 95%, ETHYL 3,5-DIAMINOBENZOATE, 98%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 2g, 100mg, 250mg, 10g.
Ethyl 3,5-diaminobenzoate (CAS 1949-51-5) is a chemical compound with the molecular formula C9H12N2O2 and a molecular weight of 180.20 g/mol. IUPAC name: ethyl 3,5-diaminobenzoate. InChIKey: IDLVQOMJOKNXSL-UHFFFAOYSA-N.
| Molecular formula | C9H12N2O2 |
|---|---|
| Molecular weight | 180.20 g/mol |
| IUPAC name | ethyl 3,5-diaminobenzoate |
| InChIKey | IDLVQOMJOKNXSL-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=CC(=C1)N)N |
Computed by PubChem (NCBI)