Products 1951441-85-2
CAS 1951441-85-2 appears in our catalog under these names: Trans-(2-fluorocyclopentyl)methanamine hydrochloride, Trans-(2-fluorocyclopentyl)methanamine hydrochloride, 95%, (trans-2-fluorocyclopentyl)methanamine hydrochloride, 97%. Offered by: Biosynth, Combi-blocks, AmBeed. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g.
[(1S,2R)-2-fluorocyclopentyl]methanamine;hydrochloride (CAS 1951441-85-2) is a chemical compound with the molecular formula C6H13ClFN and a molecular weight of 153.62 g/mol. IUPAC name: [(1S,2R)-2-fluorocyclopentyl]methanamine;hydrochloride. InChIKey: VHFQGBWOQCVVDW-RIHPBJNCSA-N.
| Molecular formula | C6H13ClFN |
|---|---|
| Molecular weight | 153.62 g/mol |
| IUPAC name | [(1S,2R)-2-fluorocyclopentyl]methanamine;hydrochloride |
| InChIKey | VHFQGBWOQCVVDW-RIHPBJNCSA-N |
| SMILES | C1C[C@H]([C@@H](C1)F)CN.Cl |
Computed by PubChem (NCBI)