CAS 1820580-16-2 appears in our catalog under these names: (1R,2R)-2-Fluorocyclohexanamine hydrochloride, (1R,2R)-2-Fluorocyclohexan-1-amine hydrochloride, 95%, (1R,2R)-2-fluorocyclohexan-1-amine hcl, 97%. Offered by: Biosynth, Combi-blocks, AmBeed. Available pack sizes: 2,5g, 250mg, 1g, 100mg, 5g, 10g.
Trans-(1R,2R)-2-fluorocyclohexan-1-amine;hydrochloride (CAS 1820580-16-2) is a chemical compound with the molecular formula C6H13ClFN and a molecular weight of 153.62 g/mol. IUPAC name: trans-(1R,2R)-2-fluorocyclohexan-1-amine;hydrochloride. InChIKey: IOXBYKGOFZSEIL-KGZKBUQUSA-N.
| Molecular formula | C6H13ClFN |
|---|---|
| Molecular weight | 153.62 g/mol |
| IUPAC name | trans-(1R,2R)-2-fluorocyclohexan-1-amine;hydrochloride |
| InChIKey | IOXBYKGOFZSEIL-KGZKBUQUSA-N |
| SMILES | C1CC[C@H]([C@@H](C1)N)F.Cl |
Computed by PubChem (NCBI)