Products 1951441-43-2
CAS 1951441-43-2 appears in our catalog under these names: Trans-3-fluorocyclohexanamine hydrochloride, 95%, trans-3-fluorocyclohexan-1-amine hydrochloride, 97%, Trans-3-fluorocyclohexanamine hydrochloride, 95%, 95%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 100mg, 250mg, 1g, 10g, 5g, 500mg.
Trans-(1R,3R)-3-fluorocyclohexan-1-amine;hydrochloride (CAS 1951441-43-2) is a chemical compound with the molecular formula C6H13ClFN and a molecular weight of 153.62 g/mol. IUPAC name: trans-(1R,3R)-3-fluorocyclohexan-1-amine;hydrochloride. InChIKey: QKCMJPLQBZUZRS-KGZKBUQUSA-N.
| Molecular formula | C6H13ClFN |
|---|---|
| Molecular weight | 153.62 g/mol |
| IUPAC name | trans-(1R,3R)-3-fluorocyclohexan-1-amine;hydrochloride |
| InChIKey | QKCMJPLQBZUZRS-KGZKBUQUSA-N |
| SMILES | C1C[C@H](C[C@@H](C1)F)N.Cl |
Computed by PubChem (NCBI)