CAS 75198-16-2 appears in our catalog under these names: trans–2–Fluorocyclohexanamine hydrochloride, Trans-2-fluorocyclohexanamine hydrochloride, 95%, trans-2-Fluorocyclohexanamine hydrochloride 95%, TRANS-2-FLUOROCYCLOHEXANAMINE HCL, 95%, trans-2-Fluorocyclohexan-1-amine HCl. Offered by: GLPBio, Combi-blocks, Ambeed, Fluorochem, Biosynth. Available pack sizes: 100mg, 1g, 250mg, 5g, 0,5g.
Trans-(1R,2R)-2-fluorocyclohexan-1-amine;hydrochloride (CAS 75198-16-2) is a chemical compound with the molecular formula C6H13ClFN and a molecular weight of 153.62 g/mol. IUPAC name: trans-(1R,2R)-2-fluorocyclohexan-1-amine;hydrochloride. InChIKey: IOXBYKGOFZSEIL-KGZKBUQUSA-N.
| Molecular formula | C6H13ClFN |
|---|---|
| Molecular weight | 153.62 g/mol |
| IUPAC name | trans-(1R,2R)-2-fluorocyclohexan-1-amine;hydrochloride |
| InChIKey | IOXBYKGOFZSEIL-KGZKBUQUSA-N |
| SMILES | C1CC[C@H]([C@@H](C1)N)F.Cl |
Computed by PubChem (NCBI)