CAS 19522-39-5 is the registry number for D-4-(Carboxyamino)-glutaramic Acid 4-Benzyl Ester. Offered by: TRC. Available pack sizes: 10mg, 25mg, 50mg.
(4R)-5-amino-5-oxo-4-(phenylmethoxycarbonylamino)pentanoic acid (CAS 19522-39-5) is a chemical compound with the molecular formula C13H16N2O5 and a molecular weight of 280.28 g/mol. IUPAC name: (4R)-5-amino-5-oxo-4-(phenylmethoxycarbonylamino)pentanoic acid. InChIKey: NHFBOIIKTDKSRE-SNVBAGLBSA-N.
| Molecular formula | C13H16N2O5 |
|---|---|
| Molecular weight | 280.28 g/mol |
| IUPAC name | (4R)-5-amino-5-oxo-4-(phenylmethoxycarbonylamino)pentanoic acid |
| InChIKey | NHFBOIIKTDKSRE-SNVBAGLBSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)N[C@H](CCC(=O)O)C(=O)N |
Computed by PubChem (NCBI)