CAS 19550-57-3 appears in our catalog under these names: 6,7-Dimethyl-1-tetralone, 95%, 6，7–Dimethyl–1–tetralone, 6,7-Dimethyl-1-tetralone, 6,7-Dimethyl-1-tetralone, >98.0%(GC), 6,7-Dimethyl-1-tetralone, 98.0%, 98.0%. Offered by: Combi-blocks, GLPBio, Biosynth, TCI, Chemat. Available pack sizes: 1g, 250mg, 200mg, 2,5g.
6,7-dimethyl-3,4-dihydro-2H-naphthalen-1-one (CAS 19550-57-3) is a chemical compound with the molecular formula C12H14O and a molecular weight of 174.24 g/mol. IUPAC name: 6,7-dimethyl-3,4-dihydro-2H-naphthalen-1-one. InChIKey: CVKLXAQUJMXVMC-UHFFFAOYSA-N.
| Molecular formula | C12H14O |
|---|---|
| Molecular weight | 174.24 g/mol |
| IUPAC name | 6,7-dimethyl-3,4-dihydro-2H-naphthalen-1-one |
| InChIKey | CVKLXAQUJMXVMC-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1C)C(=O)CCC2 |
Computed by PubChem (NCBI)