Products 1955473-81-0

CAS 1955473-81-0 is the registry number for 3-Phenoxycyclobutan-1-amine hydrochloride. Offered by: Biosynth. Available pack sizes: 100mg, 50mg, 250mg, 500mg, 1000mg.

Structural formula: {0} (CAS {1})

3-phenoxycyclobutan-1-amine;hydrochloride (CAS 1955473-81-0) is a chemical compound with the molecular formula C10H14ClNO and a molecular weight of 199.68 g/mol. IUPAC name: 3-phenoxycyclobutan-1-amine;hydrochloride. InChIKey: YPQRSWFGPZVDPT-UHFFFAOYSA-N.

Identity
Molecular formulaC10H14ClNO
Molecular weight199.68 g/mol
IUPAC name3-phenoxycyclobutan-1-amine;hydrochloride
InChIKeyYPQRSWFGPZVDPT-UHFFFAOYSA-N
SMILESC1C(CC1OC2=CC=CC=C2)N.Cl

Computed by PubChem (NCBI)