CAS 1955498-41-5 is the registry number for Methyl (2R,3S)-3-aminotetrahydrofuran-2-carboxylate hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 5g, 1g.
Methyl (2R,3S)-3-aminooxolane-2-carboxylate;hydrochloride (CAS 1955498-41-5) is a chemical compound with the molecular formula C6H12ClNO3 and a molecular weight of 181.62 g/mol. IUPAC name: methyl (2R,3S)-3-aminooxolane-2-carboxylate;hydrochloride. InChIKey: MJMLNTUSOMKSJX-UYXJWNHNSA-N.
| Molecular formula | C6H12ClNO3 |
|---|---|
| Molecular weight | 181.62 g/mol |
| IUPAC name | methyl (2R,3S)-3-aminooxolane-2-carboxylate;hydrochloride |
| InChIKey | MJMLNTUSOMKSJX-UYXJWNHNSA-N |
| SMILES | COC(=O)[C@H]1[C@H](CCO1)N.Cl |
Computed by PubChem (NCBI)