Products 2940876-10-6
CAS 2940876-10-6 appears in our catalog under these names: methyl (2R,3R)-3-aminotetrahydrofuran-2-carboxylate hydrochloride, 99%, 99%, Methyl (2R,3R)-3-aminotetrahydrofuran-2-carboxylate hydrochloride, 99%. Offered by: Chemat, Ambeed. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 500mg, 1g.
Methyl (2R,3R)-3-aminooxolane-2-carboxylate;hydrochloride (CAS 2940876-10-6) is a chemical compound with the molecular formula C6H12ClNO3 and a molecular weight of 181.62 g/mol. IUPAC name: methyl (2R,3R)-3-aminooxolane-2-carboxylate;hydrochloride. InChIKey: MJMLNTUSOMKSJX-TYSVMGFPSA-N.
| Molecular formula | C6H12ClNO3 |
|---|---|
| Molecular weight | 181.62 g/mol |
| IUPAC name | methyl (2R,3R)-3-aminooxolane-2-carboxylate;hydrochloride |
| InChIKey | MJMLNTUSOMKSJX-TYSVMGFPSA-N |
| SMILES | COC(=O)[C@H]1[C@@H](CCO1)N.Cl |
Computed by PubChem (NCBI)