CAS 1955499-58-7 is the registry number for 3-(1H-1,2,3-Triazol-4-yl)piperidin-3-ol dihydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 1g.
3-(2H-triazol-4-yl)piperidin-3-ol;dihydrochloride (CAS 1955499-58-7) is a chemical compound with the molecular formula C7H14Cl2N4O and a molecular weight of 241.12 g/mol. IUPAC name: 3-(2H-triazol-4-yl)piperidin-3-ol;dihydrochloride. InChIKey: CBEIXALJAULCIB-UHFFFAOYSA-N.
| Molecular formula | C7H14Cl2N4O |
|---|---|
| Molecular weight | 241.12 g/mol |
| IUPAC name | 3-(2H-triazol-4-yl)piperidin-3-ol;dihydrochloride |
| InChIKey | CBEIXALJAULCIB-UHFFFAOYSA-N |
| SMILES | C1CC(CNC1)(C2=NNN=C2)O.Cl.Cl |
Computed by PubChem (NCBI)