CAS 1955515-13-5 is the registry number for 5-(Piperidin-3-yl)-1,3,4-oxadiazol-2-amine dihydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
5-piperidin-3-yl-1,3,4-oxadiazol-2-amine;dihydrochloride (CAS 1955515-13-5) is a chemical compound with the molecular formula C7H14Cl2N4O and a molecular weight of 241.12 g/mol. IUPAC name: 5-piperidin-3-yl-1,3,4-oxadiazol-2-amine;dihydrochloride. InChIKey: NAIQOHBKKNPDFL-UHFFFAOYSA-N.
| Molecular formula | C7H14Cl2N4O |
|---|---|
| Molecular weight | 241.12 g/mol |
| IUPAC name | 5-piperidin-3-yl-1,3,4-oxadiazol-2-amine;dihydrochloride |
| InChIKey | NAIQOHBKKNPDFL-UHFFFAOYSA-N |
| SMILES | C1CC(CNC1)C2=NN=C(O2)N.Cl.Cl |
Computed by PubChem (NCBI)