CAS 2094860-85-0 is the registry number for 5-(3-Methoxyazetidin-3-yl)-1-methyl-1H-1,2,3-triazole dihydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 1g.
5-(3-methoxyazetidin-3-yl)-1-methyltriazole;dihydrochloride (CAS 2094860-85-0) is a chemical compound with the molecular formula C7H14Cl2N4O and a molecular weight of 241.12 g/mol. IUPAC name: 5-(3-methoxyazetidin-3-yl)-1-methyltriazole;dihydrochloride. InChIKey: QFYCKADWDARIHW-UHFFFAOYSA-N.
| Molecular formula | C7H14Cl2N4O |
|---|---|
| Molecular weight | 241.12 g/mol |
| IUPAC name | 5-(3-methoxyazetidin-3-yl)-1-methyltriazole;dihydrochloride |
| InChIKey | QFYCKADWDARIHW-UHFFFAOYSA-N |
| SMILES | CN1C(=CN=N1)C2(CNC2)OC.Cl.Cl |
Computed by PubChem (NCBI)