CAS 2137620-33-6 is the registry number for rac-(2R,3S)-2-(5-Methyl-1H-1,2,4-triazol-3-yl)oxolan-3-amine dihydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(2R,3S)-2-(5-methyl-1H-1,2,4-triazol-3-yl)oxolan-3-amine;dihydrochloride (CAS 2137620-33-6) is a chemical compound with the molecular formula C7H14Cl2N4O and a molecular weight of 241.12 g/mol. IUPAC name: (2R,3S)-2-(5-methyl-1H-1,2,4-triazol-3-yl)oxolan-3-amine;dihydrochloride. InChIKey: SOHXHZHTAAJIOP-KXSOTYCDSA-N.
| Molecular formula | C7H14Cl2N4O |
|---|---|
| Molecular weight | 241.12 g/mol |
| IUPAC name | (2R,3S)-2-(5-methyl-1H-1,2,4-triazol-3-yl)oxolan-3-amine;dihydrochloride |
| InChIKey | SOHXHZHTAAJIOP-KXSOTYCDSA-N |
| SMILES | CC1=NC(=NN1)[C@H]2[C@H](CCO2)N.Cl.Cl |
Computed by PubChem (NCBI)