Products 1955514-84-7
CAS 1955514-84-7 appears in our catalog under these names: [4-(4-Chlorophenyl)pyrrolidin-3-yl]methanol hydrochloride, 95%, (4-(4-CHlorophenyl)pyrrolidin-3-yl)methanol hydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
[4-(4-chlorophenyl)pyrrolidin-3-yl]methanol;hydrochloride (CAS 1955514-84-7) is a chemical compound with the molecular formula C11H15Cl2NO and a molecular weight of 248.15 g/mol. IUPAC name: [4-(4-chlorophenyl)pyrrolidin-3-yl]methanol;hydrochloride. InChIKey: MAQCKMCMVDAXMR-UHFFFAOYSA-N.
| Molecular formula | C11H15Cl2NO |
|---|---|
| Molecular weight | 248.15 g/mol |
| IUPAC name | [4-(4-chlorophenyl)pyrrolidin-3-yl]methanol;hydrochloride |
| InChIKey | MAQCKMCMVDAXMR-UHFFFAOYSA-N |
| SMILES | C1C(C(CN1)C2=CC=C(C=C2)Cl)CO.Cl |
Computed by PubChem (NCBI)