CAS 1197687-18-5 appears in our catalog under these names: 3-Chloro-4-(cyclopentyloxy)aniline hydrochloride, 95%, 3-Chloro-4-(cyclopentyloxy)aniline hydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
3-chloro-4-cyclopentyloxyaniline;hydrochloride (CAS 1197687-18-5) is a chemical compound with the molecular formula C11H15Cl2NO and a molecular weight of 248.15 g/mol. IUPAC name: 3-chloro-4-cyclopentyloxyaniline;hydrochloride. InChIKey: MWZCECIIYZGURX-UHFFFAOYSA-N.
| Molecular formula | C11H15Cl2NO |
|---|---|
| Molecular weight | 248.15 g/mol |
| IUPAC name | 3-chloro-4-cyclopentyloxyaniline;hydrochloride |
| InChIKey | MWZCECIIYZGURX-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)OC2=C(C=C(C=C2)N)Cl.Cl |
Computed by PubChem (NCBI)