Products 65367-99-9

CAS 65367-99-9 is the registry number for 4-(3-Chlorophenoxy)piperidine hydrochloride, 96%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 250mg.

Structural formula: {0} (CAS {1})

4-(3-chlorophenoxy)piperidine;hydrochloride (CAS 65367-99-9) is a chemical compound with the molecular formula C11H15Cl2NO and a molecular weight of 248.15 g/mol. IUPAC name: 4-(3-chlorophenoxy)piperidine;hydrochloride. InChIKey: RCKZZPLYUQTPMJ-UHFFFAOYSA-N.

Identity
Molecular formulaC11H15Cl2NO
Molecular weight248.15 g/mol
IUPAC name4-(3-chlorophenoxy)piperidine;hydrochloride
InChIKeyRCKZZPLYUQTPMJ-UHFFFAOYSA-N
SMILESC1CNCCC1OC2=CC(=CC=C2)Cl.Cl

Computed by PubChem (NCBI)