CAS 1177352-21-4 appears in our catalog under these names: 2-(3-Chloro-4-methoxyphenyl)pyrrolidine hydrochloride, 96%, 2-(3-Chloro-4-methoxyphenyl)pyrrolidine hydrochloride 98%, 2-(3-Chloro-4-methoxyphenyl)pyrrolidine hydrochloride, 98%, 98%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 10g, 5g, 25g, 1g, 25mg, 50mg, 100mg, 250mg.
2-(3-chloro-4-methoxyphenyl)pyrrolidine;hydrochloride (CAS 1177352-21-4) is a chemical compound with the molecular formula C11H15Cl2NO and a molecular weight of 248.15 g/mol. IUPAC name: 2-(3-chloro-4-methoxyphenyl)pyrrolidine;hydrochloride. InChIKey: UKTSFWUGXLYYBI-UHFFFAOYSA-N.
| Molecular formula | C11H15Cl2NO |
|---|---|
| Molecular weight | 248.15 g/mol |
| IUPAC name | 2-(3-chloro-4-methoxyphenyl)pyrrolidine;hydrochloride |
| InChIKey | UKTSFWUGXLYYBI-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C2CCCN2)Cl.Cl |
Computed by PubChem (NCBI)