Products 1955519-65-9
CAS 1955519-65-9 is the registry number for 1-(4-aminophenyl)-2-methylpropan-1-one hydrochloride, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
1-(4-aminophenyl)-2-methylpropan-1-one;hydrochloride (CAS 1955519-65-9) is a chemical compound with the molecular formula C10H14ClNO and a molecular weight of 199.68 g/mol. IUPAC name: 1-(4-aminophenyl)-2-methylpropan-1-one;hydrochloride. InChIKey: HVMQDNMVHAKLIH-UHFFFAOYSA-N.
| Molecular formula | C10H14ClNO |
|---|---|
| Molecular weight | 199.68 g/mol |
| IUPAC name | 1-(4-aminophenyl)-2-methylpropan-1-one;hydrochloride |
| InChIKey | HVMQDNMVHAKLIH-UHFFFAOYSA-N |
| SMILES | CC(C)C(=O)C1=CC=C(C=C1)N.Cl |
Computed by PubChem (NCBI)