Products 1955519-92-2
CAS 1955519-92-2 appears in our catalog under these names: 2-ETHYL-5-(FLUOROSULFONYL)BENZOIC ACID, 95%, 2-Ethyl-5-(fluorosulfonyl)benzoic acid, 95%, 95%. Offered by: Fluorochem, Ambeed, Chemat. Available pack sizes: 100mg, 250mg.
2-ethyl-5-fluorosulfonylbenzoic acid (CAS 1955519-92-2) is a chemical compound with the molecular formula C9H9FO4S and a molecular weight of 232.23 g/mol. IUPAC name: 2-ethyl-5-fluorosulfonylbenzoic acid. InChIKey: CIINUYYFFSTIRQ-UHFFFAOYSA-N.
| Molecular formula | C9H9FO4S |
|---|---|
| Molecular weight | 232.23 g/mol |
| IUPAC name | 2-ethyl-5-fluorosulfonylbenzoic acid |
| InChIKey | CIINUYYFFSTIRQ-UHFFFAOYSA-N |
| SMILES | CCC1=C(C=C(C=C1)S(=O)(=O)F)C(=O)O |
Computed by PubChem (NCBI)