CAS 1955524-40-9 is the registry number for N5-Phenylpyridine-2,5-diamine hydrochloride. Offered by: Biosynth. Available pack sizes: 100mg, 50mg, 250mg, 500mg.
5-N-phenylpyridine-2,5-diamine;hydrochloride (CAS 1955524-40-9) is a chemical compound with the molecular formula C11H12ClN3 and a molecular weight of 221.68 g/mol. IUPAC name: 5-N-phenylpyridine-2,5-diamine;hydrochloride. InChIKey: OQRARUWFVPWZLU-UHFFFAOYSA-N.
| Molecular formula | C11H12ClN3 |
|---|---|
| Molecular weight | 221.68 g/mol |
| IUPAC name | 5-N-phenylpyridine-2,5-diamine;hydrochloride |
| InChIKey | OQRARUWFVPWZLU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC2=CN=C(C=C2)N.Cl |
Computed by PubChem (NCBI)