CAS 1955553-63-5 is the registry number for N5-(3-Methoxyphenyl)pyridine-2,5-diamine hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
5-N-(3-methoxyphenyl)pyridine-2,5-diamine;hydrochloride (CAS 1955553-63-5) is a chemical compound with the molecular formula C12H14ClN3O and a molecular weight of 251.71 g/mol. IUPAC name: 5-N-(3-methoxyphenyl)pyridine-2,5-diamine;hydrochloride. InChIKey: MNTBZCMPEIEAEW-UHFFFAOYSA-N.
| Molecular formula | C12H14ClN3O |
|---|---|
| Molecular weight | 251.71 g/mol |
| IUPAC name | 5-N-(3-methoxyphenyl)pyridine-2,5-diamine;hydrochloride |
| InChIKey | MNTBZCMPEIEAEW-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC(=C1)NC2=CN=C(C=C2)N.Cl |
Computed by PubChem (NCBI)