Products 1955556-81-6

CAS 1955556-81-6 is the registry number for tert-Butyl N-{3-aminospiro(3.3)heptan-1-yl}carbamate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Tert-butyl N-(1-aminospiro[3.3]heptan-3-yl)carbamate (CAS 1955556-81-6) is a chemical compound with the molecular formula C12H22N2O2 and a molecular weight of 226.32 g/mol. IUPAC name: tert-butyl N-(1-aminospiro[3.3]heptan-3-yl)carbamate. InChIKey: VDLQWFAVDYRRGW-UHFFFAOYSA-N.

Identity
Molecular formulaC12H22N2O2
Molecular weight226.32 g/mol
IUPAC nametert-butyl N-(1-aminospiro[3.3]heptan-3-yl)carbamate
InChIKeyVDLQWFAVDYRRGW-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)NC1CC(C12CCC2)N

Computed by PubChem (NCBI)