Products 1955561-08-6
CAS 1955561-08-6 is the registry number for 5-(Aminomethyl)-4H,5H,6H,7H-pyrazolo(1,5-a)pyridine-3-carboxylic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
5-(aminomethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine-3-carboxylic acid;hydrochloride (CAS 1955561-08-6) is a chemical compound with the molecular formula C9H14ClN3O2 and a molecular weight of 231.68 g/mol. IUPAC name: 5-(aminomethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine-3-carboxylic acid;hydrochloride. InChIKey: KTXMZJUDCYIZHK-UHFFFAOYSA-N.
| Molecular formula | C9H14ClN3O2 |
|---|---|
| Molecular weight | 231.68 g/mol |
| IUPAC name | 5-(aminomethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine-3-carboxylic acid;hydrochloride |
| InChIKey | KTXMZJUDCYIZHK-UHFFFAOYSA-N |
| SMILES | C1CN2C(=C(C=N2)C(=O)O)CC1CN.Cl |
Computed by PubChem (NCBI)