CAS 1956-10-1 appears in our catalog under these names: 4-Nitrophenyl caprylate, 95%, 4-Nitrophenyl octanoate, 96% , 4-Nitrophenyl caprylate, 4-Nitrophenyl octanoate 98%, 4-NITROPHENYL OCTANOATE, >=90.0% (GC). Offered by: Combi-blocks, Thermo Scientific (Alfa Aesar), Biosynth, Ambeed, Sigma-Aldrich. Available pack sizes: 5g, 1g, 25g, 10g, 50g, 100g, 250g, 100mg.
(4-nitrophenyl) octanoate (CAS 1956-10-1) is a chemical compound with the molecular formula C14H19NO4 and a molecular weight of 265.30 g/mol. IUPAC name: (4-nitrophenyl) octanoate. InChIKey: GGIDEJQGAZSTES-UHFFFAOYSA-N.
| Molecular formula | C14H19NO4 |
|---|---|
| Molecular weight | 265.30 g/mol |
| IUPAC name | (4-nitrophenyl) octanoate |
| InChIKey | GGIDEJQGAZSTES-UHFFFAOYSA-N |
| SMILES | CCCCCCCC(=O)OC1=CC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)