CAS 195628-22-9 is the registry number for 1-tert-Butyl 3-Methoxy-4-hydroxymethylpiperidine. Offered by: TRC. Available pack sizes: 1g.
Tert-butyl (3R,4S)-4-(hydroxymethyl)-3-methoxypiperidine-1-carboxylate (CAS 195628-22-9) is a chemical compound with the molecular formula C12H23NO4 and a molecular weight of 245.32 g/mol. IUPAC name: tert-butyl (3R,4S)-4-(hydroxymethyl)-3-methoxypiperidine-1-carboxylate. InChIKey: JOSHOXKNFUGGDA-UWVGGRQHSA-N.
| Molecular formula | C12H23NO4 |
|---|---|
| Molecular weight | 245.32 g/mol |
| IUPAC name | tert-butyl (3R,4S)-4-(hydroxymethyl)-3-methoxypiperidine-1-carboxylate |
| InChIKey | JOSHOXKNFUGGDA-UWVGGRQHSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H]([C@H](C1)OC)CO |
Computed by PubChem (NCBI)