Products 1956318-87-8

CAS 1956318-87-8 is the registry number for 1-(5-(Benzyloxy)pyridin-2-yl)cyclopropanecarboxylic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 250mg.

Structural formula: {0} (CAS {1})

1-(5-phenylmethoxy-2-pyridinyl)cyclopropane-1-carboxylic acid (CAS 1956318-87-8) is a chemical compound with the molecular formula C16H15NO3 and a molecular weight of 269.29 g/mol. IUPAC name: 1-(5-phenylmethoxy-2-pyridinyl)cyclopropane-1-carboxylic acid. InChIKey: QMRDIJFMUXQKKZ-UHFFFAOYSA-N.

Identity
Molecular formulaC16H15NO3
Molecular weight269.29 g/mol
IUPAC name1-(5-phenylmethoxy-2-pyridinyl)cyclopropane-1-carboxylic acid
InChIKeyQMRDIJFMUXQKKZ-UHFFFAOYSA-N
SMILESC1CC1(C2=NC=C(C=C2)OCC3=CC=CC=C3)C(=O)O

Computed by PubChem (NCBI)