CAS 1956327-93-7 appears in our catalog under these names: 2–fluoro Deschloronorketamine (hydrochloride), 2-Fluoro deschloronorketamine hydrochloride. Offered by: GLPBio, Biosynth. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg.
2-amino-2-(2-fluorophenyl)cyclohexan-1-one;hydrochloride (CAS 1956327-93-7) is a chemical compound with the molecular formula C12H15ClFNO and a molecular weight of 243.70 g/mol. IUPAC name: 2-amino-2-(2-fluorophenyl)cyclohexan-1-one;hydrochloride. InChIKey: VOMLIFQAFQRIIL-UHFFFAOYSA-N.
| Molecular formula | C12H15ClFNO |
|---|---|
| Molecular weight | 243.70 g/mol |
| IUPAC name | 2-amino-2-(2-fluorophenyl)cyclohexan-1-one;hydrochloride |
| InChIKey | VOMLIFQAFQRIIL-UHFFFAOYSA-N |
| SMILES | C1CCC(C(=O)C1)(C2=CC=CC=C2F)N.Cl |
Computed by PubChem (NCBI)