CAS 4290-72-6 appears in our catalog under these names: 5,6-Dihydro-4h-pyrrolo[3,2,1-ij]quinoline-1,2-dione, 95%, 5,6-Dihydro-1H-pyrrolo[3,2,1-ij]quinoline-1,2(4H)-dione 95%, 5,6-Dihydro-4H-pyrrolo[3,2,1-ij]quinoline-1,2-dione, 95+%, 95+%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-triene-2,3-dione (CAS 4290-72-6) is a chemical compound with the molecular formula C11H9NO2 and a molecular weight of 187.19 g/mol. IUPAC name: 1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-triene-2,3-dione. InChIKey: KNEFHXSZIJKTPK-UHFFFAOYSA-N.
| Molecular formula | C11H9NO2 |
|---|---|
| Molecular weight | 187.19 g/mol |
| IUPAC name | 1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-triene-2,3-dione |
| InChIKey | KNEFHXSZIJKTPK-UHFFFAOYSA-N |
| SMILES | C1CC2=C3C(=CC=C2)C(=O)C(=O)N3C1 |
Computed by PubChem (NCBI)