Products 1956329-56-8
CAS 1956329-56-8 is the registry number for methyl 7-bromo-1,3-dihydroisobenzofuran-4-carboxylate, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
Methyl 7-bromo-1,3-dihydro-2-benzofuran-4-carboxylate (CAS 1956329-56-8) is a chemical compound with the molecular formula C10H9BrO3 and a molecular weight of 257.08 g/mol. IUPAC name: methyl 7-bromo-1,3-dihydro-2-benzofuran-4-carboxylate. InChIKey: HCDPHCJGFYSGME-UHFFFAOYSA-N.
| Molecular formula | C10H9BrO3 |
|---|---|
| Molecular weight | 257.08 g/mol |
| IUPAC name | methyl 7-bromo-1,3-dihydro-2-benzofuran-4-carboxylate |
| InChIKey | HCDPHCJGFYSGME-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C2COCC2=C(C=C1)Br |
Computed by PubChem (NCBI)