CAS 1956332-56-1 is the registry number for 4–chloro–1,3–diMethyl–6–phenyl–1H–pyrazolo(3,4–d)pyriMidine. Offered by: GLPBio. Available pack sizes: 200mg.
4-chloro-1,3-dimethyl-6-phenylpyrazolo[5,4-d]pyrimidine (CAS 1956332-56-1) is a chemical compound with the molecular formula C13H11ClN4 and a molecular weight of 258.70 g/mol. IUPAC name: 4-chloro-1,3-dimethyl-6-phenylpyrazolo[5,4-d]pyrimidine. InChIKey: QKSUPMDBGKJKPP-UHFFFAOYSA-N.
| Molecular formula | C13H11ClN4 |
|---|---|
| Molecular weight | 258.70 g/mol |
| IUPAC name | 4-chloro-1,3-dimethyl-6-phenylpyrazolo[5,4-d]pyrimidine |
| InChIKey | QKSUPMDBGKJKPP-UHFFFAOYSA-N |
| SMILES | CC1=NN(C2=C1C(=NC(=N2)C3=CC=CC=C3)Cl)C |
Computed by PubChem (NCBI)