CAS 885524-15-2 appears in our catalog under these names: 4-Chloro-1-(3,5-dimethylphenyl)-1h-pyrazolo[3,4-d]pyrimidine, 95%, 4-Chloro-1-(3,5-dimethylphenyl)-1H-pyrazolo(3,4-d)pyrimidine, 97%, 4-Chloro-1-(3,5-dimethylphenyl)-1H-pyrazolo(3,4-d)pyrimidine. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 100mg, 5g, 10g, 250mg, 1g, 2,5g.
4-chloro-1-(3,5-dimethylphenyl)pyrazolo[5,4-d]pyrimidine (CAS 885524-15-2) is a chemical compound with the molecular formula C13H11ClN4 and a molecular weight of 258.70 g/mol. IUPAC name: 4-chloro-1-(3,5-dimethylphenyl)pyrazolo[5,4-d]pyrimidine. InChIKey: IFYKTCBGIXRDLX-UHFFFAOYSA-N.
| Molecular formula | C13H11ClN4 |
|---|---|
| Molecular weight | 258.70 g/mol |
| IUPAC name | 4-chloro-1-(3,5-dimethylphenyl)pyrazolo[5,4-d]pyrimidine |
| InChIKey | IFYKTCBGIXRDLX-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)N2C3=C(C=N2)C(=NC=N3)Cl)C |
Computed by PubChem (NCBI)