CAS 2138221-54-0 is the registry number for 6-Chloro-2-(1-methyl-1H-pyrazol-5-yl)quinolin-4-amine, 97%. Offered by: Chemat Brand, Fluorochem. Available pack sizes: on request, 25mg, 50mg.
6-chloro-2-(2-methylpyrazol-3-yl)quinolin-4-amine (CAS 2138221-54-0) is a chemical compound with the molecular formula C13H11ClN4 and a molecular weight of 258.70 g/mol. IUPAC name: 6-chloro-2-(2-methylpyrazol-3-yl)quinolin-4-amine. InChIKey: ORTQVMAUAUDCDX-UHFFFAOYSA-N.
| Molecular formula | C13H11ClN4 |
|---|---|
| Molecular weight | 258.70 g/mol |
| IUPAC name | 6-chloro-2-(2-methylpyrazol-3-yl)quinolin-4-amine |
| InChIKey | ORTQVMAUAUDCDX-UHFFFAOYSA-N |
| SMILES | CN1C(=CC=N1)C2=NC3=C(C=C(C=C3)Cl)C(=C2)N |
Computed by PubChem (NCBI)