CAS 610277-86-6 is the registry number for 4-Chloro-1-(2,4-dimethylphenyl)-1h-pyrazolo[3,4-d]pyrimidine, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 250mg, 1g, 5g.
4-chloro-1-(2,4-dimethylphenyl)pyrazolo[5,4-d]pyrimidine (CAS 610277-86-6) is a chemical compound with the molecular formula C13H11ClN4 and a molecular weight of 258.70 g/mol. IUPAC name: 4-chloro-1-(2,4-dimethylphenyl)pyrazolo[5,4-d]pyrimidine. InChIKey: VZGUDTKDGFFRHH-UHFFFAOYSA-N.
| Molecular formula | C13H11ClN4 |
|---|---|
| Molecular weight | 258.70 g/mol |
| IUPAC name | 4-chloro-1-(2,4-dimethylphenyl)pyrazolo[5,4-d]pyrimidine |
| InChIKey | VZGUDTKDGFFRHH-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)N2C3=C(C=N2)C(=NC=N3)Cl)C |
Computed by PubChem (NCBI)