Products 1956335-74-2
CAS 1956335-74-2 appears in our catalog under these names: 1-(1H-Indazol-4-yl)ethanamine hydrochloride, 97%, 1-(1H-Indazol-4-Yl)Ethanamine Hydrochloride, 95%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g, 10g, 5g.
1-(1H-indazol-4-yl)ethanamine;hydrochloride (CAS 1956335-74-2) is a chemical compound with the molecular formula C9H12ClN3 and a molecular weight of 197.66 g/mol. IUPAC name: 1-(1H-indazol-4-yl)ethanamine;hydrochloride. InChIKey: SBDAWZDJNQOSPR-UHFFFAOYSA-N.
| Molecular formula | C9H12ClN3 |
|---|---|
| Molecular weight | 197.66 g/mol |
| IUPAC name | 1-(1H-indazol-4-yl)ethanamine;hydrochloride |
| InChIKey | SBDAWZDJNQOSPR-UHFFFAOYSA-N |
| SMILES | CC(C1=C2C=NNC2=CC=C1)N.Cl |
Computed by PubChem (NCBI)