Products 1956356-00-5
CAS 1956356-00-5 is the registry number for 3-([1,1'-Biphenyl]-2-yl)-5-(chloromethyl)-1,2,4-oxadiazole, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g, 25g.
5-(chloromethyl)-3-(2-phenylphenyl)-1,2,4-oxadiazole (CAS 1956356-00-5) is a chemical compound with the molecular formula C15H11ClN2O and a molecular weight of 270.71 g/mol. IUPAC name: 5-(chloromethyl)-3-(2-phenylphenyl)-1,2,4-oxadiazole. InChIKey: TWDBLDOENGSXMS-UHFFFAOYSA-N.
| Molecular formula | C15H11ClN2O |
|---|---|
| Molecular weight | 270.71 g/mol |
| IUPAC name | 5-(chloromethyl)-3-(2-phenylphenyl)-1,2,4-oxadiazole |
| InChIKey | TWDBLDOENGSXMS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=CC=C2C3=NOC(=N3)CCl |
Computed by PubChem (NCBI)