CAS 400075-09-4 is the registry number for 4-(4-Chlorophenyl)-2-phenyl-1,2-dihydro-3h-pyrazol-3-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
4-(4-chlorophenyl)-2-phenyl-1H-pyrazol-3-one (CAS 400075-09-4) is a chemical compound with the molecular formula C15H11ClN2O and a molecular weight of 270.71 g/mol. IUPAC name: 4-(4-chlorophenyl)-2-phenyl-1H-pyrazol-3-one. InChIKey: NQOFGHFQXWHDHE-UHFFFAOYSA-N.
| Molecular formula | C15H11ClN2O |
|---|---|
| Molecular weight | 270.71 g/mol |
| IUPAC name | 4-(4-chlorophenyl)-2-phenyl-1H-pyrazol-3-one |
| InChIKey | NQOFGHFQXWHDHE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C(=O)C(=CN2)C3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)