CAS 23085-45-2 appears in our catalog under these names: 2-(2-Chloro-1h-benzimidazol-1-yl)-1-phenylethanone, 97%, 2-(2-Chloro-1H-1,3-benzodiazol-1-yl)-1-phenylethan-1-one. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 0,5g, 50mg.
2-(2-chlorobenzimidazol-1-yl)-1-phenylethanone (CAS 23085-45-2) is a chemical compound with the molecular formula C15H11ClN2O and a molecular weight of 270.71 g/mol. IUPAC name: 2-(2-chlorobenzimidazol-1-yl)-1-phenylethanone. InChIKey: NKEGAEKDQQDLAP-UHFFFAOYSA-N.
| Molecular formula | C15H11ClN2O |
|---|---|
| Molecular weight | 270.71 g/mol |
| IUPAC name | 2-(2-chlorobenzimidazol-1-yl)-1-phenylethanone |
| InChIKey | NKEGAEKDQQDLAP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)CN2C3=CC=CC=C3N=C2Cl |
Computed by PubChem (NCBI)