CAS 36124-03-5 is the registry number for 5-(5-Chloro-2-hydroxyphenyl)-1-phenylpyrazole, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 25g, 10g, 5g.
4-chloro-2-(2-phenylpyrazol-3-yl)phenol (CAS 36124-03-5) is a chemical compound with the molecular formula C15H11ClN2O and a molecular weight of 270.71 g/mol. IUPAC name: 4-chloro-2-(2-phenylpyrazol-3-yl)phenol. InChIKey: LORUSDINHPKFMM-UHFFFAOYSA-N.
| Molecular formula | C15H11ClN2O |
|---|---|
| Molecular weight | 270.71 g/mol |
| IUPAC name | 4-chloro-2-(2-phenylpyrazol-3-yl)phenol |
| InChIKey | LORUSDINHPKFMM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C(=CC=N2)C3=C(C=CC(=C3)Cl)O |
Computed by PubChem (NCBI)