Products 1956366-63-4
CAS 1956366-63-4 is the registry number for 5-(Thiophen-2-ylmethyl)-6,7-dihydropyrazolo[1,5-a]pyrazin-4(5h)-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
5-(thiophen-2-ylmethyl)-6,7-dihydropyrazolo[1,5-a]pyrazin-4-one (CAS 1956366-63-4) is a chemical compound with the molecular formula C11H11N3OS and a molecular weight of 233.29 g/mol. IUPAC name: 5-(thiophen-2-ylmethyl)-6,7-dihydropyrazolo[1,5-a]pyrazin-4-one. InChIKey: VTDWKKONLKWRID-UHFFFAOYSA-N.
| Molecular formula | C11H11N3OS |
|---|---|
| Molecular weight | 233.29 g/mol |
| IUPAC name | 5-(thiophen-2-ylmethyl)-6,7-dihydropyrazolo[1,5-a]pyrazin-4-one |
| InChIKey | VTDWKKONLKWRID-UHFFFAOYSA-N |
| SMILES | C1CN2C(=CC=N2)C(=O)N1CC3=CC=CS3 |
Computed by PubChem (NCBI)